ChemNet > CAS > 37593-06-9 1-(4-decylfenyl)ethan-1-on
37593-06-9 1-(4-decylfenyl)ethan-1-on
Naam product |
1-(4-decylfenyl)ethan-1-on |
Synoniemen |
1-(4-decylfenyl)ethanon |
Engelse naam |
1-(4-decylphenyl)ethan-1-one;1-(4-decylphenyl)ethanone |
MF |
C18H28O |
Molecuulgewicht |
260.4143 |
InChI |
InChI=1/C18H28O/c1-3-4-5-6-7-8-9-10-11-17-12-14-18(15-13-17)16(2)19/h12-15H,3-11H2,1-2H3 |
CAS-nummer |
37593-06-9 |
Moleculaire Structuur |
|
Dichtheid |
0.911g/cm3 |
Smeltpunt |
33℃ |
Kookpunt |
371.4°C at 760 mmHg |
Brekingsindex |
1.491 |
Vlampunt |
156.6°C |
Dampdruk |
1.04E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|