ChemNet > CAS > 37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
Naam product |
Methyl 1-methylpyrrole-2-carboxylate |
Engelse naam |
Methyl 1-methylpyrrole-2-carboxylate; 1-Methylpyrrole-2-carboxylic acid methyl ester; methyl 1-methyl-1H-pyrrole-2-carboxylate |
MF |
C7H9NO2 |
Molecuulgewicht |
139.1519 |
InChI |
InChI=1/C7H9NO2/c1-8-5-3-4-6(8)7(9)10-2/h3-5H,1-2H3 |
CAS-nummer |
37619-24-2 |
Moleculaire Structuur |
|
Dichtheid |
1.07g/cm3 |
Kookpunt |
204.7°C at 760 mmHg |
Brekingsindex |
1.5 |
Vlampunt |
77.6°C |
Dampdruk |
0.26mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|