ChemNet > CAS > 37885-41-9 1-(2,4-Dichlorophenyl)-1-propanone
37885-41-9 1-(2,4-Dichlorophenyl)-1-propanone
| Naam product |
1-(2,4-Dichlorophenyl)-1-propanone |
| Engelse naam |
1-(2,4-Dichlorophenyl)-1-propanone; 2,4-Dichloropropiophenone; 2',4'-DICHLOROPROPIOPHENONE |
| MF |
C9H8Cl2O |
| Molecuulgewicht |
203.06 |
| InChI |
InChI=1/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
| CAS-nummer |
37885-41-9 |
| EINECS |
253-700-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.287 |
| Brekingsindex |
1.551-1.553 |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
