ChemNet > CAS > 38226-10-7 6-Fluorosalicylaldehyde
38226-10-7 6-Fluorosalicylaldehyde
Naam product |
6-Fluorosalicylaldehyde |
Engelse naam |
6-Fluorosalicylaldehyde; 2-Fluoro-6-hydroxybenzaldehyde |
MF |
C7H5FO2 |
Molecuulgewicht |
140.1118 |
InChI |
InChI=1/C7H5FO2/c8-6-2-1-3-7(10)5(6)4-9/h1-4,10H |
CAS-nummer |
38226-10-7 |
Moleculaire Structuur |
|
Dichtheid |
1.35g/cm3 |
Kookpunt |
201.3°C at 760 mmHg |
Brekingsindex |
1.587 |
Vlampunt |
75.6°C |
Dampdruk |
0.218mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|