38291-82-6 Valeric acid hydrazide
Naam product |
Valeric acid hydrazide |
Engelse naam |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
MF |
C5H12N2O |
Molecuulgewicht |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
CAS-nummer |
38291-82-6 |
EINECS |
253-864-8 |
Moleculaire Structuur |
|
Dichtheid |
0.962g/cm3 |
Kookpunt |
260.6°C at 760 mmHg |
Brekingsindex |
1.449 |
Vlampunt |
111.4°C |
Dampdruk |
0.0122mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|