ChemNet > CAS > 38460-95-6 10-Undecenoyl chloride
38460-95-6 10-Undecenoyl chloride
| Naam product |
10-Undecenoyl chloride |
| Engelse naam |
10-Undecenoyl chloride; Undecenoylchloride; ; 10-Undeconyl chloride |
| MF |
C11H19ClO |
| Molecuulgewicht |
202.72 |
| InChI |
InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2 |
| CAS-nummer |
38460-95-6 |
| EINECS |
253-951-0 |
| Moleculaire Structuur |
|
| Dichtheid |
0.94 |
| Kookpunt |
120-122℃ (10 torr) |
| Brekingsindex |
1.4532-1.4552 |
| Vlampunt |
93℃ |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
