ChemNet > CAS > 38594-42-2 Dichlorobenzylalcohol; 98%
38594-42-2 Dichlorobenzylalcohol; 98%
Naam product |
Dichlorobenzylalcohol; 98% |
Engelse naam |
Dichlorobenzylalcohol; 98%; 2,3-Dichlorobenzyl alcohol; (2,3-dichlorophenyl)methanol |
MF |
C7H6Cl2O |
Molecuulgewicht |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
CAS-nummer |
38594-42-2 |
Moleculaire Structuur |
|
Dichtheid |
1.392g/cm3 |
Smeltpunt |
85-88℃ |
Kookpunt |
271.2°C at 760 mmHg |
Brekingsindex |
1.582 |
Vlampunt |
115.8°C |
Dampdruk |
0.00321mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|