ChemNet > CAS > 38690-76-5 4-cyanofenyl-4-heptylbenzoaat
38690-76-5 4-cyanofenyl-4-heptylbenzoaat
Naam product |
4-cyanofenyl-4-heptylbenzoaat |
Synoniemen |
4-n-Heptylbenzoëzuur, 4-Cyanofenylester |
Engelse naam |
4-Cyanophenyl 4-heptylbenzoate; 4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
MF |
C21H23NO2 |
Molecuulgewicht |
321.4128 |
InChI |
InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
CAS-nummer |
38690-76-5 |
EINECS |
254-084-0 |
Moleculaire Structuur |
|
Dichtheid |
1.09g/cm3 |
Smeltpunt |
43-45℃ |
Kookpunt |
476.4°C at 760 mmHg |
Brekingsindex |
1.56 |
Vlampunt |
238.3°C |
Dampdruk |
3.07E-09mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|