3878-55-5 mono-Methyl succinate
Naam product |
mono-Methyl succinate |
Engelse naam |
mono-Methyl succinate; Succinic acid monomethyl ester; methyl hydrogen succinate; mono-Methyl hydrogen succinate; 4-Methoxy-4-oxobutanoic acid; 4-methoxy-4-oxobutanoate |
MF |
C5H7O4 |
Molecuulgewicht |
131.1072 |
InChI |
InChI=1/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7)/p-1 |
CAS-nummer |
3878-55-5 |
EINECS |
223-408-2 |
Moleculaire Structuur |
|
Smeltpunt |
55-59℃ |
Kookpunt |
259.2°C at 760 mmHg |
Vlampunt |
104.5°C |
Dampdruk |
0.00394mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|