ChemNet > CAS > 38861-78-8 4-Isobutylacetophenone
38861-78-8 4-Isobutylacetophenone
| Naam product |
4-Isobutylacetophenone |
| Engelse naam |
4-Isobutylacetophenone; 4-Isobutylacetaphenone; TIMTEC-BB SBB007668; P-ISO-BUTYLACETOPHENONE; IBUPROFEN IMPURITY E; IBUPROFEN IMP E; ISOBUTYL ACETOPHENONE; 4'-ISOBUTYLACETOPHENONE; 1-[4-(2-METHYLPROPYL)PHENYL]ETHANONE; 4-methyl-3-phenylpentan-2-one; 4'-(2-Methylpropyl)Acetophenone; 1Y1&1R DV1 |
| MF |
C12H16O |
| Molecuulgewicht |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-9(2)12(10(3)13)11-7-5-4-6-8-11/h4-9,12H,1-3H3 |
| CAS-nummer |
38861-78-8 |
| EINECS |
254-159-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.944g/cm3 |
| Kookpunt |
240.8°C at 760 mmHg |
| Brekingsindex |
1.494 |
| Vlampunt |
87°C |
| Dampdruk |
0.0372mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
