ChemNet > CAS > 392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
Naam product |
Methyl 4-fluoro-2-hydroxybenzoate |
Engelse naam |
Methyl 4-fluoro-2-hydroxybenzoate; Methyl 4-fluorosalicylate; 4-Fluorosalicylic acid methyl ester; Methyl 4-fluoro-2-hydroxybenzoate; 4-Fluoro-6-hydroxy-benzoic acid methyl ester |
MF |
C8H7FO3 |
Molecuulgewicht |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
CAS-nummer |
392-04-1 |
Moleculaire Structuur |
|
Dichtheid |
1.309g/cm3 |
Kookpunt |
224.7°C at 760 mmHg |
Brekingsindex |
1.526 |
Vlampunt |
89.7°C |
Dampdruk |
0.0603mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|