394-35-4 methyl 2-fluorobenzoate
Naam product |
methyl 2-fluorobenzoate |
Engelse naam |
methyl 2-fluorobenzoate; 2-Fluorobenzoic acid methyl ester |
MF |
C8H7FO2 |
Molecuulgewicht |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS-nummer |
394-35-4 |
EINECS |
206-894-0 |
Moleculaire Structuur |
|
Dichtheid |
1.21 |
Kookpunt |
99℃ (18 torr) |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|