ChemNet > CAS > 39745-40-9 5-Amino-6-chloro-2-picoline
39745-40-9 5-Amino-6-chloro-2-picoline
| Naam product |
5-Amino-6-chloro-2-picoline |
| Engelse naam |
5-Amino-6-chloro-2-picoline; 3-Amino-2-chloro-6-picoline; 2-chloro-3-amino-6-methylpyridine; 2-chloro-6-methylpyridin-3-amine; 2-Chloro-6-methyl-pyridin-3-ylamine; 3-Amino-2-chloro-6-methylpyridine |
| MF |
C6H7ClN2 |
| Molecuulgewicht |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c1-4-2-3-5(8)6(7)9-4/h2-3H,8H2,1H3 |
| CAS-nummer |
39745-40-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.26g/cm3 |
| Kookpunt |
262.3°C at 760 mmHg |
| Brekingsindex |
1.592 |
| Vlampunt |
112.5°C |
| Dampdruk |
0.011mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
