ChemNet > CAS > 39905-44-7 p-Heptyloxyaniline
39905-44-7 p-Heptyloxyaniline
| Naam product |
p-Heptyloxyaniline |
| Engelse naam |
p-Heptyloxyaniline; 4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
| MF |
C13H21NO |
| Molecuulgewicht |
207.3119 |
| InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
| CAS-nummer |
39905-44-7 |
| Moleculaire Structuur |
|
| Dichtheid |
0.965g/cm3 |
| Kookpunt |
325.9°C at 760 mmHg |
| Brekingsindex |
1.516 |
| Vlampunt |
145°C |
| Dampdruk |
0.000223mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
