ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
Naam product |
3,5-Dichlorophenylhydrazine |
Engelse naam |
3,5-Dichlorophenylhydrazine; |
MF |
C6H6Cl2N2 |
Molecuulgewicht |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
CAS-nummer |
39943-56-1 |
Moleculaire Structuur |
|
Dichtheid |
1.475g/cm3 |
Kookpunt |
286.1°C at 760 mmHg |
Brekingsindex |
1.665 |
Vlampunt |
126.8°C |
Dampdruk |
0.0027mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|