ChemNet > CAS > 39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
| Naam product |
5-Methoxy-1-methylindole-3-carboxaldehyde |
| Engelse naam |
5-Methoxy-1-methylindole-3-carboxaldehyde; 3-Formyl-5-methoxy-1-methylindole; 5-methoxy-1-methyl-1H-indole-3-carbaldehyde |
| MF |
C11H11NO2 |
| Molecuulgewicht |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3 |
| CAS-nummer |
39974-94-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.14g/cm3 |
| Kookpunt |
357.9°C at 760 mmHg |
| Brekingsindex |
1.565 |
| Vlampunt |
170.2°C |
| Dampdruk |
2.65E-05mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|