ChemNet > CAS > 3999-55-1 Diethyl trans-1,2-cyclopropanedicarboxylate
3999-55-1 Diethyl trans-1,2-cyclopropanedicarboxylate
Naam product |
Diethyl trans-1,2-cyclopropanedicarboxylate |
Engelse naam |
Diethyl trans-1,2-cyclopropanedicarboxylate; diethyl (1R,2R)-cyclopropane-1,2-dicarboxylate |
MF |
C9H14O4 |
Molecuulgewicht |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1 |
CAS-nummer |
3999-55-1 |
Moleculaire Structuur |
|
Dichtheid |
1.153g/cm3 |
Kookpunt |
246.288°C at 760 mmHg |
Brekingsindex |
1.469 |
Vlampunt |
98.333°C |
Dampdruk |
0.027mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|