40101-17-5 m-Anisil
Naam product |
m-Anisil |
Engelse naam |
m-Anisil; 3,3-Dimethoxybenzil; 3,3-Dimethoxydibenzoyl; 1,2-bis(3-methoxyphenyl)ethane-1,2-dione |
MF |
C16H14O4 |
Molecuulgewicht |
270.28 |
InChI |
InChI=1/C16H14O4/c1-19-13-7-3-5-11(9-13)15(17)16(18)12-6-4-8-14(10-12)20-2/h3-10H,1-2H3 |
CAS-nummer |
40101-17-5 |
EINECS |
254-793-5 |
Moleculaire Structuur |
|
Dichtheid |
1.183g/cm3 |
Kookpunt |
442.2°C at 760 mmHg |
Brekingsindex |
1.566 |
Vlampunt |
197.5°C |
Dampdruk |
5.13E-08mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|