ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
| Naam product |
1-(3-fluorophenyl)ethanol |
| Engelse naam |
1-(3-fluorophenyl)ethanol; 3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
| MF |
C8H9FO |
| Molecuulgewicht |
140.1549 |
| InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| CAS-nummer |
402-63-1 |
| EINECS |
206-950-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.123g/cm3 |
| Kookpunt |
196.2°C at 760 mmHg |
| Brekingsindex |
1.51 |
| Vlampunt |
90.1°C |
| Dampdruk |
0.251mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
