ChemNet > CAS > 40784-88-1 Ethyl 4-ethoxyphenylacetate
40784-88-1 Ethyl 4-ethoxyphenylacetate
Naam product |
Ethyl 4-ethoxyphenylacetate |
Engelse naam |
Ethyl 4-ethoxyphenylacetate; 4-Ethoxyphenylacetic acid ethyl ester |
MF |
C12H16O3 |
Molecuulgewicht |
208.2536 |
InChI |
InChI=1/C12H16O3/c1-3-14-11-7-5-10(6-8-11)9-12(13)15-4-2/h5-8H,3-4,9H2,1-2H3 |
CAS-nummer |
40784-88-1 |
Moleculaire Structuur |
|
Dichtheid |
1.045g/cm3 |
Kookpunt |
289.2°C at 760 mmHg |
Brekingsindex |
1.495 |
Vlampunt |
116.8°C |
Dampdruk |
0.00224mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|