4079-52-1 2-Methoxyacetophenone
Naam product |
2-Methoxyacetophenone |
Engelse naam |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
MF |
C9H10O2 |
Molecuulgewicht |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
CAS-nummer |
4079-52-1 |
EINECS |
223-802-4 |
Moleculaire Structuur |
|
Dichtheid |
1.035g/cm3 |
Smeltpunt |
7-8℃ |
Kookpunt |
245°C at 760 mmHg |
Brekingsindex |
1.504 |
Vlampunt |
92.8°C |
Dampdruk |
0.0294mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|