ChemNet > CAS > 40877-09-6 4,4'-Dichlorobutyrophenone
40877-09-6 4,4'-Dichlorobutyrophenone
Naam product |
4,4'-Dichlorobutyrophenone |
Engelse naam |
4,4'-Dichlorobutyrophenone; 4-Chloro-1-(4-chlorophenyl)-1-butanone; 4-chloro-1-(4-chlorophenyl)butan-1-one |
MF |
C10H10Cl2O |
Molecuulgewicht |
217.0918 |
InChI |
InChI=1/C10H10Cl2O/c11-7-1-2-10(13)8-3-5-9(12)6-4-8/h3-6H,1-2,7H2 |
CAS-nummer |
40877-09-6 |
EINECS |
255-123-4 |
Moleculaire Structuur |
|
Dichtheid |
1.224g/cm3 |
Smeltpunt |
29-30℃ |
Kookpunt |
333.8°C at 760 mmHg |
Brekingsindex |
1.536 |
Vlampunt |
140.7°C |
Dampdruk |
0.000133mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|