ChemNet > CAS > 41513-32-0 trans-1,4-Cyclohexenediol
41513-32-0 trans-1,4-Cyclohexenediol
| Naam product |
trans-1,4-Cyclohexenediol |
| Synoniemen |
(1S,4S)-cyclohex-2-een-1,4-diol; (1R,4S)-cyclohex-2-een-1,4-diol; (1R,4R)-cyclohex-2-een-1,4-diol |
| Engelse naam |
trans-1,4-Cyclohexenediol;(1S,4S)-cyclohex-2-ene-1,4-diol; (1R,4S)-cyclohex-2-ene-1,4-diol; (1R,4R)-cyclohex-2-ene-1,4-diol |
| MF |
C6H10O2 |
| Molecuulgewicht |
114.1424 |
| InChI |
InChI=1/C6H10O2/c7-5-1-2-6(8)4-3-5/h1-2,5-8H,3-4H2/t5-,6-/m0/s1 |
| CAS-nummer |
41513-32-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.217g/cm3 |
| Smeltpunt |
84-87℃ |
| Kookpunt |
242.8°C at 760 mmHg |
| Brekingsindex |
1.563 |
| Vlampunt |
119.3°C |
| Dampdruk |
0.00565mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
