ChemNet > CAS > 41667-95-2 5,6-dichloronicotinic acid
41667-95-2 5,6-dichloronicotinic acid
| Naam product |
5,6-dichloronicotinic acid |
| Engelse naam |
5,6-dichloronicotinic acid; 5,6-Dichloropyridine-3-carboxylic acid; 5,6-dichloro nicotinic acid |
| MF |
C6H3Cl2NO2 |
| Molecuulgewicht |
191.9995 |
| InChI |
InChI=1/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
| CAS-nummer |
41667-95-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.612g/cm3 |
| Smeltpunt |
164-168℃ |
| Kookpunt |
342.1°C at 760 mmHg |
| Brekingsindex |
1.605 |
| Vlampunt |
160.7°C |
| Dampdruk |
2.96E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S22:;
S24/25:;
|
|
