ChemNet > CAS > 41727-47-3 3,5-Dibromo-4-hydroxybenzoic acid methyl ester
41727-47-3 3,5-Dibromo-4-hydroxybenzoic acid methyl ester
| Naam product |
3,5-Dibromo-4-hydroxybenzoic acid methyl ester |
| Engelse naam |
3,5-Dibromo-4-hydroxybenzoic acid methyl ester; Methyl 3,5-dibromo-4-hydroxybenzoate |
| MF |
C8H6Br2O3 |
| Molecuulgewicht |
309.9394 |
| InChI |
InChI=1/C8H6Br2O3/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,11H,1H3 |
| CAS-nummer |
41727-47-3 |
| EINECS |
255-521-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.96g/cm3 |
| Smeltpunt |
122℃ |
| Kookpunt |
297.2°C at 760 mmHg |
| Brekingsindex |
1.616 |
| Vlampunt |
133.5°C |
| Dampdruk |
0.000775mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
