ChemNet > CAS > 4214-79-3 5-Chloro-2-pyridinol
4214-79-3 5-Chloro-2-pyridinol
| Naam product |
5-Chloro-2-pyridinol |
| Engelse naam |
5-Chloro-2-pyridinol; 5-Chloro-2-hydroxypyridine; 5-Chloro-2-hydrxypyridine; 2-Hydroxy-5-chloropyridine; 2-hydroxy-5-chloro pyridine; 5-chloropyridin-2(1H)-one; 5-Chloropyridin-2-ol; 5-Chloropyridin-2-ol |
| MF |
C5H4ClNO |
| Molecuulgewicht |
129.5444 |
| InChI |
InChI=1/C5H4ClNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) |
| CAS-nummer |
4214-79-3 |
| EINECS |
224-146-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.35g/cm3 |
| Smeltpunt |
162-165℃ |
| Kookpunt |
290.7°C at 760 mmHg |
| Brekingsindex |
1.569 |
| Vlampunt |
129.6°C |
| Dampdruk |
0.00204mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
