ChemNet > CAS > 42712-64-1 2-Amino-4-hydroxyquinoline hydrate
42712-64-1 2-Amino-4-hydroxyquinoline hydrate
| Naam product |
2-Amino-4-hydroxyquinoline hydrate |
| Engelse naam |
2-Amino-4-hydroxyquinoline hydrate; 2-Aminoquinolinol hydrate; 2-aminoquinolin-4(1H)-one; 2-Amino-4-1H-quinolinone |
| MF |
C9H8N2O |
| Molecuulgewicht |
160.1726 |
| InChI |
InChI=1/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) |
| CAS-nummer |
42712-64-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.254g/cm3 |
| Kookpunt |
294.1°C at 760 mmHg |
| Brekingsindex |
1.623 |
| Vlampunt |
131.7°C |
| Dampdruk |
0.00166mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
