ChemNet > CAS > 42783-78-8 Benzyloxyacetaldehyde diethyl acetal
42783-78-8 Benzyloxyacetaldehyde diethyl acetal
Naam product |
Benzyloxyacetaldehyde diethyl acetal |
Engelse naam |
Benzyloxyacetaldehyde diethyl acetal; 1,1-diethoxy-2-benzyloxyethane; [(2,2-diethoxyethoxy)methyl]benzene |
MF |
C13H20O3 |
Molecuulgewicht |
224.2961 |
InChI |
InChI=1/C13H20O3/c1-3-15-13(16-4-2)11-14-10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
CAS-nummer |
42783-78-8 |
Moleculaire Structuur |
|
Dichtheid |
1g/cm3 |
Kookpunt |
288.8°C at 760 mmHg |
Brekingsindex |
1.484 |
Vlampunt |
110.9°C |
Dampdruk |
0.00397mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|