ChemNet > CAS > 43020-38-8 2,3,4-Trimethoxybenzonitrile
43020-38-8 2,3,4-Trimethoxybenzonitrile
| Naam product |
2,3,4-Trimethoxybenzonitrile |
| Engelse naam |
2,3,4-Trimethoxybenzonitrile; |
| MF |
C10H11NO3 |
| Molecuulgewicht |
193.1992 |
| InChI |
InChI=1/C10H11NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,1-3H3 |
| CAS-nummer |
43020-38-8 |
| EINECS |
256-049-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.15g/cm3 |
| Smeltpunt |
55-57℃ |
| Kookpunt |
311.1°C at 760 mmHg |
| Brekingsindex |
1.514 |
| Vlampunt |
127.8°C |
| Dampdruk |
0.000576mmHg at 25°C |
| Gevaarsymbolen |
 T:Toxic;
|
| Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
