ChemNet > CAS > 43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
Naam product |
Ethyl 2-amino-4-methylthiophene-3-carboxylate |
Engelse naam |
Ethyl 2-amino-4-methylthiophene-3-carboxylate; 2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester |
MF |
C8H11NO2S |
Molecuulgewicht |
185.2434 |
InChI |
InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
CAS-nummer |
43088-42-2 |
Moleculaire Structuur |
|
Dichtheid |
1.219g/cm3 |
Smeltpunt |
72℃ |
Kookpunt |
279.1°C at 760 mmHg |
Brekingsindex |
1.573 |
Vlampunt |
122.6°C |
Dampdruk |
0.00411mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|