ChemNet > CAS > 4472-92-8 Cinnamylidenemalonic acid
4472-92-8 Cinnamylidenemalonic acid
Naam product |
Cinnamylidenemalonic acid |
Engelse naam |
Cinnamylidenemalonic acid; 2-Carboxy-5-phenyl-2,4-pentadienoic acid; (3-phenylprop-2-en-1-ylidene)propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioate |
MF |
C12H8O4 |
Molecuulgewicht |
216.1906 |
InChI |
InChI=1/C12H10O4/c13-11(14)10(12(15)16)8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,14)(H,15,16)/p-2/b7-4+ |
CAS-nummer |
4472-92-8 |
EINECS |
224-746-3 |
Moleculaire Structuur |
|
Kookpunt |
484.6°C at 760 mmHg |
Vlampunt |
261°C |
Dampdruk |
3.34E-10mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|