ChemNet > CAS > 4476-28-2 4-Isopropylphenylacetic acid
4476-28-2 4-Isopropylphenylacetic acid
| Naam product |
4-Isopropylphenylacetic acid |
| Engelse naam |
4-Isopropylphenylacetic acid; AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
| MF |
C11H13O2 |
| Molecuulgewicht |
177.2203 |
| InChI |
InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| CAS-nummer |
4476-28-2 |
| EINECS |
224-755-2 |
| Moleculaire Structuur |
|
| Kookpunt |
295°C at 760 mmHg |
| Vlampunt |
192.1°C |
| Dampdruk |
0.00071mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
