ChemNet > CAS > 4521-33-9 5-Nitrothiophene-2-carboxaldehyde
4521-33-9 5-Nitrothiophene-2-carboxaldehyde
Naam product |
5-Nitrothiophene-2-carboxaldehyde |
Engelse naam |
5-Nitrothiophene-2-carboxaldehyde;5-Nitrothiophene-2-carbaldehyde |
MF |
C5H3NO3S |
Molecuulgewicht |
157.1472 |
InChI |
InChI=1/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
CAS-nummer |
4521-33-9 |
EINECS |
224-850-9 |
Moleculaire Structuur |
|
Dichtheid |
1.534g/cm3 |
Kookpunt |
297.2°C at 760 mmHg |
Brekingsindex |
1.662 |
Vlampunt |
133.5°C |
Dampdruk |
0.00137mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|