ChemNet > CAS > 45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
Naam product |
3-Amino-5-methylthio-1H-1,2,4-triazole |
Engelse naam |
3-Amino-5-methylthio-1H-1,2,4-triazole; |
MF |
C3H6N4S |
Molecuulgewicht |
130.1715 |
InChI |
InChI=1/C3H6N4S/c1-8-3-5-2(4)6-7-3/h1H3,(H3,4,5,6,7) |
CAS-nummer |
45534-08-5 |
EINECS |
256-242-4 |
Moleculaire Structuur |
|
Dichtheid |
1.46g/cm3 |
Smeltpunt |
130-133℃ |
Kookpunt |
393.7°C at 760 mmHg |
Brekingsindex |
1.652 |
Vlampunt |
191.9°C |
Dampdruk |
2.08E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|