ChemNet > CAS > 458-92-4 alpha,alpha-Difluoroanisole
458-92-4 alpha,alpha-Difluoroanisole
Naam product |
alpha,alpha-Difluoroanisole |
Engelse naam |
alpha,alpha-Difluoroanisole; (Difluoromethoxy)benzene |
MF |
C7H6F2O |
Molecuulgewicht |
144.1187 |
InChI |
InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
CAS-nummer |
458-92-4 |
EINECS |
207-283-1 |
Moleculaire Structuur |
|
Dichtheid |
1.155g/cm3 |
Kookpunt |
138°C at 760 mmHg |
Brekingsindex |
1.445 |
Vlampunt |
43.1°C |
Dampdruk |
8.52mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|