459-47-2 1,4-ethylfluorobenzene
Naam product |
1,4-ethylfluorobenzene |
Engelse naam |
1,4-ethylfluorobenzene; 1-Ethyl-4-fluorobenzene; benzene, 1-ethyl-4-fluoro-; Ethyl-4-fluorobenzene |
MF |
C8H9F |
Molecuulgewicht |
124.1555 |
InChI |
InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
CAS-nummer |
459-47-2 |
Moleculaire Structuur |
|
Dichtheid |
0.981g/cm3 |
Kookpunt |
141.6°C at 760 mmHg |
Brekingsindex |
1.477 |
Vlampunt |
28.9°C |
Dampdruk |
7.26mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|