ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
Naam product |
Methyl cyclopentanecarboxylate |
Engelse naam |
Methyl cyclopentanecarboxylate; Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
MF |
C7H12O2 |
Molecuulgewicht |
128.169 |
InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
CAS-nummer |
4630-80-2 |
EINECS |
225-049-7 |
Moleculaire Structuur |
|
Dichtheid |
1.014g/cm3 |
Kookpunt |
159°C at 760 mmHg |
Brekingsindex |
1.45 |
Vlampunt |
43.6°C |
Dampdruk |
2.55mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|