ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
Naam product |
2-aminothiophene-3-carbonitrile |
Engelse naam |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
MF |
C5H4N2S |
Molecuulgewicht |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
CAS-nummer |
4651-82-5 |
Moleculaire Structuur |
|
Dichtheid |
1.33g/cm3 |
Smeltpunt |
104℃ |
Kookpunt |
317.5°C at 760 mmHg |
Brekingsindex |
1.627 |
Vlampunt |
145.8°C |
Dampdruk |
0.000384mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|