ChemNet > CAS > 465514-59-4 1-(2,6-difluorfenyl)-2-fenyl-1-ethanon
465514-59-4 1-(2,6-difluorfenyl)-2-fenyl-1-ethanon
| Naam product |
1-(2,6-difluorfenyl)-2-fenyl-1-ethanon |
| Synoniemen |
1-(2,6-difluorfenyl)-2-fenylethanon |
| Engelse naam |
1-(2,6-difluorophenyl)-2-phenyl-1-ethanone;1-(2,6-difluorophenyl)-2-phenylethanone |
| MF |
C14H10F2O |
| Molecuulgewicht |
232.2254 |
| InChI |
InChI=1/C14H10F2O/c15-11-7-4-8-12(16)14(11)13(17)9-10-5-2-1-3-6-10/h1-8H,9H2 |
| CAS-nummer |
465514-59-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.221g/cm3 |
| Kookpunt |
317.6°C at 760 mmHg |
| Brekingsindex |
1.552 |
| Vlampunt |
121.8°C |
| Dampdruk |
0.000381mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
