ChemNet > CAS > 4707-47-5 Methyl-2,4-dihydroxy-3,6-dimethylbenzoate
4707-47-5 Methyl-2,4-dihydroxy-3,6-dimethylbenzoate
| Naam product |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate |
| Engelse naam |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate; |
| MF |
C10H12O4 |
| Molecuulgewicht |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 |
| CAS-nummer |
4707-47-5 |
| EINECS |
225-193-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.251g/cm3 |
| Kookpunt |
360.7°C at 760 mmHg |
| Brekingsindex |
1.57 |
| Vlampunt |
143.9°C |
| Dampdruk |
1.05E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
