ChemNet > CAS > 4740-22-1 2-amino-1-(4-nitrofenyl)ethan-1-on hydrochloridehydraat
4740-22-1 2-amino-1-(4-nitrofenyl)ethan-1-on hydrochloridehydraat
| Naam product |
2-amino-1-(4-nitrofenyl)ethan-1-on hydrochloridehydraat |
| Synoniemen |
2-amino-1-(4-nitrofenyl)ethaanhydrochloridehydraat |
| Engelse naam |
2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate;2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| MF |
C8H11ClN2O4 |
| Molecuulgewicht |
234.6369 |
| InChI |
InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| CAS-nummer |
4740-22-1 |
| Moleculaire Structuur |
|
| Smeltpunt |
134℃ |
| Kookpunt |
339.1°C at 760 mmHg |
| Vlampunt |
158.9°C |
| Dampdruk |
9.39E-05mmHg at 25°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
