480-93-3 1H-indol-3-ol
Naam product |
1H-indol-3-ol |
Engelse naam |
1H-indol-3-ol; 3-Hydroxyindole; 1-Boc-1H-Indol-3-ol |
MF |
C8H7NO |
Molecuulgewicht |
133.15 |
InChI |
InChI=1/C8H7NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1-5,9-10H |
CAS-nummer |
480-93-3 |
Moleculaire Structuur |
|
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|