ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
Naam product |
4-(difluoromethoxy)benzoic acid |
Engelse naam |
4-(difluoromethoxy)benzoic acid;4-(difluoromethoxy)benzoate |
MF |
C8H5F2O3 |
Molecuulgewicht |
187.1209 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
CAS-nummer |
4837-20-1 |
Moleculaire Structuur |
|
Smeltpunt |
169-171℃ |
Kookpunt |
272.1°C at 760 mmHg |
Vlampunt |
118.3°C |
Dampdruk |
0.00304mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|