ChemNet > CAS > 484-66-2 2,3,4,5,6-Pentamethylbenzyl alcohol
484-66-2 2,3,4,5,6-Pentamethylbenzyl alcohol
Naam product |
2,3,4,5,6-Pentamethylbenzyl alcohol |
Engelse naam |
2,3,4,5,6-Pentamethylbenzyl alcohol;(pentamethylphenyl)methanol |
MF |
C12H18O |
Molecuulgewicht |
178.2707 |
InChI |
InChI=1/C12H18O/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h13H,6H2,1-5H3 |
CAS-nummer |
484-66-2 |
EINECS |
207-609-2 |
Moleculaire Structuur |
|
Dichtheid |
0.965g/cm3 |
Kookpunt |
256°C at 760 mmHg |
Brekingsindex |
1.527 |
Vlampunt |
116°C |
Dampdruk |
0.00816mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|