ChemNet > CAS > 4919-33-9 4-Ethoxyphenylacetic acid
4919-33-9 4-Ethoxyphenylacetic acid
Naam product |
4-Ethoxyphenylacetic acid |
Engelse naam |
4-Ethoxyphenylacetic acid;Benzeneacetic acid, 4-ethoxy-; (4-ethoxyphenyl)acetate |
MF |
C10H11O3 |
Molecuulgewicht |
179.1931 |
InChI |
InChI=1/C10H12O3/c1-2-13-9-5-3-8(4-6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)/p-1 |
CAS-nummer |
4919-33-9 |
EINECS |
225-545-3 |
Moleculaire Structuur |
|
Smeltpunt |
86-90℃ |
Kookpunt |
318.5°C at 760 mmHg |
Vlampunt |
125.8°C |
Dampdruk |
0.000151mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|