ChemNet > CAS > 4971-56-6 Tetrahydrofuran-2,4-dione
4971-56-6 Tetrahydrofuran-2,4-dione
| Naam product |
Tetrahydrofuran-2,4-dione |
| Engelse naam |
Tetrahydrofuran-2,4-dione; Tetronicacidmin; beta-oxo-gamma-butyrolactone; 4-Hydroxy-2(5H)-furanone; Tetrahydro-2,4-furandione; 2,4(3H,5H)-Furandione; furan-2,4(3H,5H)-dione |
| MF |
C4H4O3 |
| Molecuulgewicht |
100.0728 |
| InChI |
InChI=1/C4H4O3/c5-3-1-4(6)7-2-3/h1-2H2 |
| CAS-nummer |
4971-56-6 |
| EINECS |
225-617-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.375g/cm3 |
| Smeltpunt |
142-147℃ |
| Kookpunt |
324.3°C at 760 mmHg |
| Brekingsindex |
1.47 |
| Vlampunt |
151.1°C |
| Dampdruk |
0.000248mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
