ChemNet > CAS > 49763-65-7 4-Pentylbenzoyl chloride
49763-65-7 4-Pentylbenzoyl chloride
| Naam product |
4-Pentylbenzoyl chloride |
| Engelse naam |
4-Pentylbenzoyl chloride; 4-n-Amylbenzoyl chloride; Benzoyl chloride, 4-pentyl- |
| MF |
C12H15ClO |
| Molecuulgewicht |
210.6999 |
| InChI |
InChI=1/C12H15ClO/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3 |
| CAS-nummer |
49763-65-7 |
| EINECS |
256-478-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.063g/cm3 |
| Kookpunt |
288.4°C at 760 mmHg |
| Brekingsindex |
1.516 |
| Vlampunt |
130.3°C |
| Dampdruk |
0.00234mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
