ChemNet > CAS > 4981-63-9 4'-Chlorobutyrophenone
4981-63-9 4'-Chlorobutyrophenone
| Naam product |
4'-Chlorobutyrophenone |
| Engelse naam |
4'-Chlorobutyrophenone; 1-(4-Chlorophenyl)-1-butanone; 4-Chlorobutyrophenone; 1-(4-chlorophenyl)butan-1-one; 4-chloro-1-phenylbutan-1-one |
| MF |
C10H11ClO |
| Molecuulgewicht |
182.6467 |
| InChI |
InChI=1/C10H11ClO/c11-8-4-7-10(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| CAS-nummer |
4981-63-9 |
| EINECS |
225-631-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.104g/cm3 |
| Smeltpunt |
36-39℃ |
| Kookpunt |
285.9°C at 760 mmHg |
| Brekingsindex |
1.521 |
| Vlampunt |
145.5°C |
| Dampdruk |
0.00272mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
