4981-63-9 4'-Chlorobutyrophenone
Naam product |
4'-Chlorobutyrophenone |
Engelse naam |
4'-Chlorobutyrophenone; 1-(4-Chlorophenyl)-1-butanone; 4-Chlorobutyrophenone; 1-(4-chlorophenyl)butan-1-one; 4-chloro-1-phenylbutan-1-one |
MF |
C10H11ClO |
Molecuulgewicht |
182.6467 |
InChI |
InChI=1/C10H11ClO/c11-8-4-7-10(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
CAS-nummer |
4981-63-9 |
EINECS |
225-631-0 |
Moleculaire Structuur |
|
Dichtheid |
1.104g/cm3 |
Smeltpunt |
36-39℃ |
Kookpunt |
285.9°C at 760 mmHg |
Brekingsindex |
1.521 |
Vlampunt |
145.5°C |
Dampdruk |
0.00272mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|