ChemNet > CAS > 499771-09-4 methyl-3-amino-4-cyano-5-piperidinothiofeen-2-carboxylaat
499771-09-4 methyl-3-amino-4-cyano-5-piperidinothiofeen-2-carboxylaat
Naam product |
methyl-3-amino-4-cyano-5-piperidinothiofeen-2-carboxylaat |
Synoniemen |
methyl-3-amino-4-cyano-5-piperidine-1-ylthiofeen-2-carboxylaat |
Engelse naam |
methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate;methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
MF |
C12H15N3O2S |
Molecuulgewicht |
265.3314 |
InChI |
InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
CAS-nummer |
499771-09-4 |
Moleculaire Structuur |
|
Dichtheid |
1.33g/cm3 |
Smeltpunt |
183℃ |
Kookpunt |
506.1°C at 760 mmHg |
Brekingsindex |
1.613 |
Vlampunt |
259.9°C |
Dampdruk |
2.29E-10mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|