ChemNet > CAS > 50-66-8 6-(Methylthio)purine
50-66-8 6-(Methylthio)purine
| Naam product |
6-(Methylthio)purine |
| Engelse naam |
6-(Methylthio)purine; 6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
| MF |
C6H6N4S |
| Molecuulgewicht |
166.2036 |
| InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
| CAS-nummer |
50-66-8 |
| EINECS |
200-057-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.59g/cm3 |
| Smeltpunt |
221-222℃ |
| Kookpunt |
290.9°C at 760 mmHg |
| Brekingsindex |
1.806 |
| Vlampunt |
129.7°C |
| Dampdruk |
0.00351mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
